Products 667940-24-1
CAS 667940-24-1 is the registry number for 9-(naphthalen-2-yl)-10-(4-(naphthalen-2-yl)phenyl)anthracene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
9-naphthalen-2-yl-10-(4-naphthalen-2-ylphenyl)anthracene (CAS 667940-24-1) is a chemical compound with the molecular formula C40H26 and a molecular weight of 506.6 g/mol. IUPAC name: 9-naphthalen-2-yl-10-(4-naphthalen-2-ylphenyl)anthracene. InChIKey: UVKXKMPWVQQLGE-UHFFFAOYSA-N.
| Molecular formula | C40H26 |
|---|---|
| Molecular weight | 506.6 g/mol |
| IUPAC name | 9-naphthalen-2-yl-10-(4-naphthalen-2-ylphenyl)anthracene |
| InChIKey | UVKXKMPWVQQLGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C4=C5C=CC=CC5=C(C6=CC=CC=C64)C7=CC8=CC=CC=C8C=C7 |
Computed by PubChem (NCBI)