Products 1364078-75-0
CAS 1364078-75-0 appears in our catalog under these names: Betovumeline (hydrochloride), (1R,5R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)-3-azabicyclo[3.1.0]hexane hydrochloride, 97%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 100mg, 250mg.
5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole;hydrochloride (CAS 1364078-75-0) is a chemical compound with the molecular formula C8H12ClN3O and a molecular weight of 201.65 g/mol. IUPAC name: 5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole;hydrochloride. InChIKey: LFFMTVIROSODDO-QMGYSKNISA-N.
| Molecular formula | C8H12ClN3O |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | LFFMTVIROSODDO-QMGYSKNISA-N |
| SMILES | CC1=NOC(=N1)[C@]23C[C@H]2CNC3.Cl |
Computed by PubChem (NCBI)