CAS 1364716-74-4 is the registry number for 5,6-Dichloro-3-((2-(trimethylsilyl)ethoxy)methyl)-3h-imidazo(4,5-b)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(5,6-dichloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane (CAS 1364716-74-4) is a chemical compound with the molecular formula C12H17Cl2N3OSi and a molecular weight of 318.27 g/mol. IUPAC name: 2-[(5,6-dichloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane. InChIKey: RBNGXKBJOMYXIG-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3OSi |
|---|---|
| Molecular weight | 318.27 g/mol |
| IUPAC name | 2-[(5,6-dichloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | RBNGXKBJOMYXIG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C=NC2=CC(=C(N=C21)Cl)Cl |
Computed by PubChem (NCBI)