CAS 1878111-51-3 is the registry number for 2,4-Dichloro-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo(3,2-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane (CAS 1878111-51-3) is a chemical compound with the molecular formula C12H17Cl2N3OSi and a molecular weight of 318.27 g/mol. IUPAC name: 2-[(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane. InChIKey: ULPZLZRREVRBAS-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3OSi |
|---|---|
| Molecular weight | 318.27 g/mol |
| IUPAC name | 2-[(2,4-dichloropyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | ULPZLZRREVRBAS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)