Products 1364718-04-6
CAS 1364718-04-6 is the registry number for Ethyl 2-(5-bromopyridin-2-yl)-2-methylpropanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(5-bromo-2-pyridinyl)-2-methylpropanoate (CAS 1364718-04-6) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: ethyl 2-(5-bromo-2-pyridinyl)-2-methylpropanoate. InChIKey: QUYRKMIPYLJRIF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | ethyl 2-(5-bromo-2-pyridinyl)-2-methylpropanoate |
| InChIKey | QUYRKMIPYLJRIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)