CAS 1364917-13-4 appears in our catalog under these names: 3, 5–Dibromo–2–fluoropyridin–4–amine, 3,5-Dibromo-2-fluoropyridin-4-amine, 97%, 3,5-Dibromo-2-fluoropyridin-4-amine, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
3,5-dibromo-2-fluoropyridin-4-amine (CAS 1364917-13-4) is a chemical compound with the molecular formula C5H3Br2FN2 and a molecular weight of 269.90 g/mol. IUPAC name: 3,5-dibromo-2-fluoropyridin-4-amine. InChIKey: YQZSVJKIFBZOGE-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2FN2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 3,5-dibromo-2-fluoropyridin-4-amine |
| InChIKey | YQZSVJKIFBZOGE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)Br)N)Br |
Computed by PubChem (NCBI)