Products 1820604-11-2
CAS 1820604-11-2 appears in our catalog under these names: 3,5-Dibromo-4-fluoropyridin-2-amine, 95%, 3,5-Dibromo-4-fluoropyridin-2-amine, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
3,5-dibromo-4-fluoropyridin-2-amine (CAS 1820604-11-2) is a chemical compound with the molecular formula C5H3Br2FN2 and a molecular weight of 269.90 g/mol. IUPAC name: 3,5-dibromo-4-fluoropyridin-2-amine. InChIKey: WIBJWXWDOPATBK-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2FN2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 3,5-dibromo-4-fluoropyridin-2-amine |
| InChIKey | WIBJWXWDOPATBK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Br)F)Br |
Computed by PubChem (NCBI)