Products 1365066-87-0
CAS 1365066-87-0 is the registry number for (4-Oxo-4H-pyrido[1,2-a]pyrimidin-7-yl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
(4-oxopyrido[1,2-a]pyrimidin-7-yl)boronic acid (CAS 1365066-87-0) is a chemical compound with the molecular formula C8H7BN2O3 and a molecular weight of 189.97 g/mol. IUPAC name: (4-oxopyrido[1,2-a]pyrimidin-7-yl)boronic acid. InChIKey: LZJCNBPPPRAMBE-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O3 |
|---|---|
| Molecular weight | 189.97 g/mol |
| IUPAC name | (4-oxopyrido[1,2-a]pyrimidin-7-yl)boronic acid |
| InChIKey | LZJCNBPPPRAMBE-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C(=NC=CC2=O)C=C1)(O)O |
Computed by PubChem (NCBI)