Products 1426221-34-2
CAS 1426221-34-2 is the registry number for (7-Oxo-7,8-dihydro-1,8-naphthyridin-3-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(7-oxo-8H-1,8-naphthyridin-3-yl)boronic acid (CAS 1426221-34-2) is a chemical compound with the molecular formula C8H7BN2O3 and a molecular weight of 189.97 g/mol. IUPAC name: (7-oxo-8H-1,8-naphthyridin-3-yl)boronic acid. InChIKey: UONUPAGJHBYFSV-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O3 |
|---|---|
| Molecular weight | 189.97 g/mol |
| IUPAC name | (7-oxo-8H-1,8-naphthyridin-3-yl)boronic acid |
| InChIKey | UONUPAGJHBYFSV-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NC(=O)C=C2)N=C1)(O)O |
Computed by PubChem (NCBI)