CAS 1365272-00-9 is the registry number for 3-Fluoro-5-methoxy-4'-methylthiobiphenyl, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-fluoro-3-methoxy-5-(4-methylsulfanylphenyl)benzene (CAS 1365272-00-9) is a chemical compound with the molecular formula C14H13FOS and a molecular weight of 248.32 g/mol. IUPAC name: 1-fluoro-3-methoxy-5-(4-methylsulfanylphenyl)benzene. InChIKey: VZWOBFKLJLVVIP-UHFFFAOYSA-N.
| Molecular formula | C14H13FOS |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 1-fluoro-3-methoxy-5-(4-methylsulfanylphenyl)benzene |
| InChIKey | VZWOBFKLJLVVIP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=CC=C(C=C2)SC)F |
Computed by PubChem (NCBI)