Products 2918881-86-2
CAS 2918881-86-2 is the registry number for (2-fluoro-5-(methylthio)phenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-fluoro-5-methylsulfanylphenyl)-phenylmethanol (CAS 2918881-86-2) is a chemical compound with the molecular formula C14H13FOS and a molecular weight of 248.32 g/mol. IUPAC name: (2-fluoro-5-methylsulfanylphenyl)-phenylmethanol. InChIKey: AWIHSHSVURUYQV-UHFFFAOYSA-N.
| Molecular formula | C14H13FOS |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (2-fluoro-5-methylsulfanylphenyl)-phenylmethanol |
| InChIKey | AWIHSHSVURUYQV-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1)F)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)