CAS 1365272-50-9 is the registry number for 4-Bromo-N-cyclopentyl-5-fluoro-2-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-N-cyclopentyl-5-fluoro-2-nitroaniline (CAS 1365272-50-9) is a chemical compound with the molecular formula C11H12BrFN2O2 and a molecular weight of 303.13 g/mol. IUPAC name: 4-bromo-N-cyclopentyl-5-fluoro-2-nitroaniline. InChIKey: BLQQQCGCZYHGCT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFN2O2 |
|---|---|
| Molecular weight | 303.13 g/mol |
| IUPAC name | 4-bromo-N-cyclopentyl-5-fluoro-2-nitroaniline |
| InChIKey | BLQQQCGCZYHGCT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=CC(=C(C=C2[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)