Products 909020-06-0
CAS 909020-06-0 is the registry number for (S)-2-(Bromomethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(bromomethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine (CAS 909020-06-0) is a chemical compound with the molecular formula C11H12BrFN2O2 and a molecular weight of 303.13 g/mol. IUPAC name: (2S)-2-(bromomethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine. InChIKey: NHYAUAQQTUMXTA-VIFPVBQESA-N.
| Molecular formula | C11H12BrFN2O2 |
|---|---|
| Molecular weight | 303.13 g/mol |
| IUPAC name | (2S)-2-(bromomethyl)-1-(2-fluoro-4-nitrophenyl)pyrrolidine |
| InChIKey | NHYAUAQQTUMXTA-VIFPVBQESA-N |
| SMILES | C1C[C@H](N(C1)C2=C(C=C(C=C2)[N+](=O)[O-])F)CBr |
Computed by PubChem (NCBI)