CAS 1365272-99-6 is the registry number for 4-Bromo-N-cyclohexyl-2,3-difluoro-6-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-N-cyclohexyl-2,3-difluoro-6-nitroaniline (CAS 1365272-99-6) is a chemical compound with the molecular formula C12H13BrF2N2O2 and a molecular weight of 335.14 g/mol. IUPAC name: 4-bromo-N-cyclohexyl-2,3-difluoro-6-nitroaniline. InChIKey: IOWVSUZCYPHGOP-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF2N2O2 |
|---|---|
| Molecular weight | 335.14 g/mol |
| IUPAC name | 4-bromo-N-cyclohexyl-2,3-difluoro-6-nitroaniline |
| InChIKey | IOWVSUZCYPHGOP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C(=C(C=C2[N+](=O)[O-])Br)F)F |
Computed by PubChem (NCBI)