CAS 2270905-17-2 is the registry number for 1-(5-Bromo-2-nitro-benzyl)-4,4-difluoro-piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(5-bromo-2-nitrophenyl)methyl]-4,4-difluoropiperidine (CAS 2270905-17-2) is a chemical compound with the molecular formula C12H13BrF2N2O2 and a molecular weight of 335.14 g/mol. IUPAC name: 1-[(5-bromo-2-nitrophenyl)methyl]-4,4-difluoropiperidine. InChIKey: LJJVSBGIGDVYBT-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF2N2O2 |
|---|---|
| Molecular weight | 335.14 g/mol |
| IUPAC name | 1-[(5-bromo-2-nitrophenyl)methyl]-4,4-difluoropiperidine |
| InChIKey | LJJVSBGIGDVYBT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CC2=C(C=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)