CAS 1365420-03-6 is the registry number for O-(Methyl(1-methylethoxy)phosphinyl)-L-tyrosine. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-amino-3-[4-[methyl(propan-2-yloxy)phosphoryl]oxyphenyl]propanoic acid (CAS 1365420-03-6) is a chemical compound with the molecular formula C13H20NO5P and a molecular weight of 301.27 g/mol. IUPAC name: (2S)-2-amino-3-[4-[methyl(propan-2-yloxy)phosphoryl]oxyphenyl]propanoic acid. InChIKey: FLDDXZZMLYFZHL-SVZXGPMESA-N.
| Molecular formula | C13H20NO5P |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[methyl(propan-2-yloxy)phosphoryl]oxyphenyl]propanoic acid |
| InChIKey | FLDDXZZMLYFZHL-SVZXGPMESA-N |
| SMILES | CC(C)OP(=O)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)