Products 259827-72-0
CAS 259827-72-0 is the registry number for Methyl 4-nitrophenyl hexylphosphonate. Offered by: Biosynth. Available pack sizes: 1g.
1-[hexyl(methoxy)phosphoryl]oxy-4-nitrobenzene (CAS 259827-72-0) is a chemical compound with the molecular formula C13H20NO5P and a molecular weight of 301.27 g/mol. IUPAC name: 1-[hexyl(methoxy)phosphoryl]oxy-4-nitrobenzene. InChIKey: RMJQAOXPKANPMM-UHFFFAOYSA-N.
| Molecular formula | C13H20NO5P |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | 1-[hexyl(methoxy)phosphoryl]oxy-4-nitrobenzene |
| InChIKey | RMJQAOXPKANPMM-UHFFFAOYSA-N |
| SMILES | CCCCCCP(=O)(OC)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-[hexyl(methoxy)phosphoryl]oxy-4-nitrobenzene, Phosphonic acid, hexyl-, methyl 4-nitrophenyl ester, Methyl (4-nitrophenyl) hexylphosphonate, methyl p-nitrophenyl n-hexylphosphonate, Lipase Suicide Inhibitor C01, Methyl 4-nitrophenyl hexyl phosphonate, 1-[hexyl(methoxy)phosphoryl]oxy-4-nitro-benzene, Methyl 4-nitrophenyl hexylphosphonate, >=95.0% (HPLC)