CAS 1365480-13-2 appears in our catalog under these names: 4'-Bromo-2,7-di-tert-butyl-9,9'-spirobi[fluorene], 98%, 98%, 4'-Bromo-2,7-di-tert-butyl-9,9'-spirobi[fluorene], 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene] (CAS 1365480-13-2) is a chemical compound with the molecular formula C33H31Br and a molecular weight of 507.5 g/mol. IUPAC name: 4-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene]. InChIKey: SUVOJNFHZCSQGA-UHFFFAOYSA-N.
| Molecular formula | C33H31Br |
|---|---|
| Molecular weight | 507.5 g/mol |
| IUPAC name | 4-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene] |
| InChIKey | SUVOJNFHZCSQGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=C(C24C5=C(C6=CC=CC=C46)C(=CC=C5)Br)C=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)