CAS 393841-81-1 appears in our catalog under these names: 2'-Bromo-2,7-di-tert-butyl-9,9'-spirobi[fluorene], 98%, 98%, 2'-Bromo-2,7-di-tert-butyl-9,9'-spirobi[fluorene], 97%, 2'-Bromo-2,7-di-tert-butyl-9,9'-spirobi[fluorene], 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 500g.
2-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene] (CAS 393841-81-1) is a chemical compound with the molecular formula C33H31Br and a molecular weight of 507.5 g/mol. IUPAC name: 2-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene]. InChIKey: BBKNCZFSPQICQT-UHFFFAOYSA-N.
| Molecular formula | C33H31Br |
|---|---|
| Molecular weight | 507.5 g/mol |
| IUPAC name | 2-bromo-2',7'-ditert-butyl-9,9'-spirobi[fluorene] |
| InChIKey | BBKNCZFSPQICQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=C(C24C5=CC=CC=C5C6=C4C=C(C=C6)Br)C=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)