CAS 1365694-03-6 appears in our catalog under these names: 17(R)-Protectin D1, 17(R)–Protectin D1. Offered by: TargetMol, GLPBio. Available pack sizes: 25ug, 10μg, 25μg.
(4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid (CAS 1365694-03-6) is a chemical compound with the molecular formula C22H32O4 and a molecular weight of 360.5 g/mol. IUPAC name: (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid. InChIKey: CRDZYJSQHCXHEG-HBMALMRFSA-N.
| Molecular formula | C22H32O4 |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| InChIKey | CRDZYJSQHCXHEG-HBMALMRFSA-N |
| SMILES | CC/C=C\C[C@H](/C=C\C=C\C=C\[C@@H](C/C=C\C/C=C\CCC(=O)O)O)O |
Computed by PubChem (NCBI)