CAS 1365962-07-7 is the registry number for 2-Chloro-n-(3-cyano-4,5-dihydronaphtho[1,2-b]thien-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)acetamide (CAS 1365962-07-7) is a chemical compound with the molecular formula C15H11ClN2OS and a molecular weight of 302.8 g/mol. IUPAC name: 2-chloro-N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)acetamide. InChIKey: AUKQUKFLVMAESM-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2OS |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 2-chloro-N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)acetamide |
| InChIKey | AUKQUKFLVMAESM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=C2C#N)NC(=O)CCl |
Computed by PubChem (NCBI)