CAS 81066-84-4 is the registry number for 3-(3-Chloro-2-methylphenyl)-2-thioxo-2,3-dihydro-4(1H)-quinazolinone. Offered by: Biosynth. Available pack sizes: 5g.
3-(3-chloro-2-methylphenyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 81066-84-4) is a chemical compound with the molecular formula C15H11ClN2OS and a molecular weight of 302.8 g/mol. IUPAC name: 3-(3-chloro-2-methylphenyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: SMZLGTJMCJQGIL-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2OS |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 3-(3-chloro-2-methylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | SMZLGTJMCJQGIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)N2C(=O)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)