Products 1365962-92-0

CAS 1365962-92-0 is the registry number for 2-Azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid (CAS 1365962-92-0) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: 2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid. InChIKey: MTVFVWNOZKFGNF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO2
Molecular weight153.18 g/mol
IUPAC name2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid
InChIKeyMTVFVWNOZKFGNF-UHFFFAOYSA-N
SMILESC1C2CNC(C1C(=O)O)C=C2

Computed by PubChem (NCBI)