CAS 1365964-11-9 is the registry number for 5-Chloro-1,3-dimethyl-6-propyl-1,6-dihydro-7h-pyrazolo[4,3-d]pyrimidin-7-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-1,3-dimethyl-6-propylpyrazolo[4,5-d]pyrimidin-7-one (CAS 1365964-11-9) is a chemical compound with the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. IUPAC name: 5-chloro-1,3-dimethyl-6-propylpyrazolo[4,5-d]pyrimidin-7-one. InChIKey: VDCNGFQQPGUHJP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4O |
|---|---|
| Molecular weight | 240.69 g/mol |
| IUPAC name | 5-chloro-1,3-dimethyl-6-propylpyrazolo[4,5-d]pyrimidin-7-one |
| InChIKey | VDCNGFQQPGUHJP-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(C(=NN2C)C)N=C1Cl |
Computed by PubChem (NCBI)