CAS 215366-29-3 appears in our catalog under these names: Acetamiprid Impurity 1, Acetamiprid Metabolite IM-1-2, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x1ml.
(E)-1-[(6-chloro-3-pyridinyl)methyl-methylamino]ethylideneurea (CAS 215366-29-3) is a chemical compound with the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. IUPAC name: (E)-1-[(6-chloro-3-pyridinyl)methyl-methylamino]ethylideneurea. InChIKey: ISBUGOZWWNMPPC-VGOFMYFVSA-N.
| Molecular formula | C10H13ClN4O |
|---|---|
| Molecular weight | 240.69 g/mol |
| IUPAC name | (E)-1-[(6-chloro-3-pyridinyl)methyl-methylamino]ethylideneurea |
| InChIKey | ISBUGOZWWNMPPC-VGOFMYFVSA-N |
| SMILES | C/C(=N\C(=O)N)/N(C)CC1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)