Products 1365987-23-0
CAS 1365987-23-0 appears in our catalog under these names: Lurasidone Impurity 62, exo-2,3-Norbornanedicarboxylic Acid Monoamide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
(1R,2S,3R,4S)-3-carbamoylbicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1365987-23-0) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: (1R,2S,3R,4S)-3-carbamoylbicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: PJARUKXCFRFPOP-WNJXEPBRSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-carbamoylbicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | PJARUKXCFRFPOP-WNJXEPBRSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H]([C@H]2C(=O)O)C(=O)N |
Computed by PubChem (NCBI)