CAS 1366050-42-1 is the registry number for 6–Chloro–3–nitro–(1,5)naphthyridin–4–ol. Offered by: GLPBio. Available pack sizes: 1g.
6-chloro-3-nitro-1H-1,5-naphthyridin-4-one (CAS 1366050-42-1) is a chemical compound with the molecular formula C8H4ClN3O3 and a molecular weight of 225.59 g/mol. IUPAC name: 6-chloro-3-nitro-1H-1,5-naphthyridin-4-one. InChIKey: FURSTBLOQYSOEM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3O3 |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 6-chloro-3-nitro-1H-1,5-naphthyridin-4-one |
| InChIKey | FURSTBLOQYSOEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=C(C2=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)