CAS 1565503-27-6 appears in our catalog under these names: 8-Chloro-6-nitro-3,4-dihydroquinazolin-4-one, 95%, 8-Chloro-6-nitro-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-chloro-6-nitro-3H-quinazolin-4-one (CAS 1565503-27-6) is a chemical compound with the molecular formula C8H4ClN3O3 and a molecular weight of 225.59 g/mol. IUPAC name: 8-chloro-6-nitro-3H-quinazolin-4-one. InChIKey: DPQYRQZFXFLCQH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3O3 |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 8-chloro-6-nitro-3H-quinazolin-4-one |
| InChIKey | DPQYRQZFXFLCQH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)NC=N2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)