CAS 13663-23-5 appears in our catalog under these names: 1-(4-Nitrophenyl)azepane, 95%, 1-(4-Nitrophenyl)azepane, 1-(4-nitrophenyl)azepane, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 10g.
1-(4-nitrophenyl)azepane (CAS 13663-23-5) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 1-(4-nitrophenyl)azepane. InChIKey: WXAAQKMTSQDMII-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 1-(4-nitrophenyl)azepane |
| InChIKey | WXAAQKMTSQDMII-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)