CAS 13663-59-7 is the registry number for N-Cyclohexyl-4-nitroaniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
N-cyclohexyl-4-nitroaniline (CAS 13663-59-7) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: N-cyclohexyl-4-nitroaniline. InChIKey: DWNVLQGHNLUJTJ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | N-cyclohexyl-4-nitroaniline |
| InChIKey | DWNVLQGHNLUJTJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)