CAS 1366960-14-6 is the registry number for 1-(tert-Butoxycarbonyl)-4-(4-hydroxyphenyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-hydroxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1366960-14-6) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: YEQAEEHLROODEZ-UHFFFAOYSA-N.
| Molecular formula | C16H21NO5 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | YEQAEEHLROODEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)C(=O)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)