Products 136765-34-9
CAS 136765-34-9 is the registry number for Ecgonine-D3 Methyl Ester 0.1 mg/ml in Acetonitrile. Offered by: LoGiCal. Available pack sizes: 1ml.
Methyl (1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 136765-34-9) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 202.27 g/mol. IUPAC name: methyl (1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: QIQNNBXHAYSQRY-ZZNOJACOSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | methyl (1R,2R,3S,5S)-3-hydroxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | QIQNNBXHAYSQRY-ZZNOJACOSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@H]2CC[C@@H]1[C@H]([C@H](C2)O)C(=O)OC |
Computed by PubChem (NCBI)