Products 65913-90-8

CAS 65913-90-8 is the registry number for (+)-Pseudoecgonine Methyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 100mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 65913-90-8) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: methyl 3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: QIQNNBXHAYSQRY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO3
Molecular weight199.25 g/mol
IUPAC namemethyl 3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
InChIKeyQIQNNBXHAYSQRY-UHFFFAOYSA-N
SMILESCN1C2CCC1C(C(C2)O)C(=O)OC

Computed by PubChem (NCBI)