CAS 1367706-85-1 appears in our catalog under these names: 2-Hydroxy-4,8-dimethyl-7-bromo-quinoline, 95%, 7-Bromo-4,8-dimethylquinolin-2-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7-bromo-4,8-dimethyl-1H-quinolin-2-one (CAS 1367706-85-1) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 7-bromo-4,8-dimethyl-1H-quinolin-2-one. InChIKey: SGZDTRWYFQYXKH-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 7-bromo-4,8-dimethyl-1H-quinolin-2-one |
| InChIKey | SGZDTRWYFQYXKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=CC(=C2C)Br |
Computed by PubChem (NCBI)