CAS 1189106-80-6 appears in our catalog under these names: 7-Bromo-2,8-dimethyl-4-hydroxyquinoline, 95%, 7-Bromo-2,8-dimethylquinolin-4-ol, 98%, 7-bromo-2,8-dimethyl-1,4-dihydroquinolin-4-one, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-bromo-2,8-dimethyl-1H-quinolin-4-one (CAS 1189106-80-6) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 7-bromo-2,8-dimethyl-1H-quinolin-4-one. InChIKey: ZBMQLNRKZDXRPA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 7-bromo-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | ZBMQLNRKZDXRPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=C(C=C2)Br)C |
Computed by PubChem (NCBI)