Products 1367815-84-6
CAS 1367815-84-6 is the registry number for 7-(Propan-2-yl)pyrazolo(1,5-a)pyrimidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-propan-2-ylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 1367815-84-6) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 7-propan-2-ylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: UXIYVRZFGKZRGV-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 7-propan-2-ylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | UXIYVRZFGKZRGV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=NC2=CC(=NN12)C(=O)O |
Computed by PubChem (NCBI)