CAS 13680-12-1 is the registry number for 8-Nitro-1,2,3,4-tetrahydrodibenzo[b,d]furan, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-nitro-1,2,3,4-tetrahydrodibenzofuran (CAS 13680-12-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 8-nitro-1,2,3,4-tetrahydrodibenzofuran. InChIKey: BYZZDUWXRGPYJS-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 8-nitro-1,2,3,4-tetrahydrodibenzofuran |
| InChIKey | BYZZDUWXRGPYJS-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)