Products 1368039-76-2

CAS 1368039-76-2 is the registry number for Ethyl 4-ethoxy-2,3-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-ethoxy-2,3-dimethylbenzoate (CAS 1368039-76-2) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: ethyl 4-ethoxy-2,3-dimethylbenzoate. InChIKey: RJGIPQBBYDUJEN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC nameethyl 4-ethoxy-2,3-dimethylbenzoate
InChIKeyRJGIPQBBYDUJEN-UHFFFAOYSA-N
SMILESCCOC1=C(C(=C(C=C1)C(=O)OCC)C)C

Computed by PubChem (NCBI)