CAS 1368104-37-3 is the registry number for rel-Methyl (2R,3S)-3-(aminomethyl)-1-methylpyrrolidine-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
Methyl (2R,3S)-3-(aminomethyl)-1-methylpyrrolidine-2-carboxylate (CAS 1368104-37-3) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: methyl (2R,3S)-3-(aminomethyl)-1-methylpyrrolidine-2-carboxylate. InChIKey: GRLWOOQOUFTIKU-NKWVEPMBSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | methyl (2R,3S)-3-(aminomethyl)-1-methylpyrrolidine-2-carboxylate |
| InChIKey | GRLWOOQOUFTIKU-NKWVEPMBSA-N |
| SMILES | CN1CC[C@H]([C@@H]1C(=O)OC)CN |
Computed by PubChem (NCBI)