Products 136834-39-4
CAS 136834-39-4 is the registry number for 2-Chloro-2’-deoxy inosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 136834-39-4) is a chemical compound with the molecular formula C10H11ClN4O4 and a molecular weight of 286.67 g/mol. IUPAC name: 2-chloro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: PFZWCXFVGJYNGP-KVQBGUIXSA-N.
| Molecular formula | C10H11ClN4O4 |
|---|---|
| Molecular weight | 286.67 g/mol |
| IUPAC name | 2-chloro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | PFZWCXFVGJYNGP-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)Cl)CO)O |
Computed by PubChem (NCBI)