Products 5466-11-5
CAS 5466-11-5 is the registry number for 2-Chloro-9-(beta-D-ribofuranosyl)purine. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
2-(2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 5466-11-5) is a chemical compound with the molecular formula C10H11ClN4O4 and a molecular weight of 286.67 g/mol. IUPAC name: 2-(2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: DXGGYSNDZSUEHC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O4 |
|---|---|
| Molecular weight | 286.67 g/mol |
| IUPAC name | 2-(2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | DXGGYSNDZSUEHC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)Cl)N(C=N2)C3C(C(C(O3)CO)O)O |
Computed by PubChem (NCBI)