Products 1368355-35-4

CAS 1368355-35-4 is the registry number for 4-(tert-Butyl)-1,2,5-oxadiazole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-tert-butyl-1,2,5-oxadiazole-3-carboxylic acid (CAS 1368355-35-4) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: 4-tert-butyl-1,2,5-oxadiazole-3-carboxylic acid. InChIKey: HFPQNDFSWIKXQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O3
Molecular weight170.17 g/mol
IUPAC name4-tert-butyl-1,2,5-oxadiazole-3-carboxylic acid
InChIKeyHFPQNDFSWIKXQJ-UHFFFAOYSA-N
SMILESCC(C)(C)C1=NON=C1C(=O)O

Computed by PubChem (NCBI)