Products 1368450-32-1
CAS 1368450-32-1 is the registry number for 2-(6-Fluoro-1-methyl-1H-indol-3-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6-fluoro-1-methylindol-3-yl)acetonitrile (CAS 1368450-32-1) is a chemical compound with the molecular formula C11H9FN2 and a molecular weight of 188.20 g/mol. IUPAC name: 2-(6-fluoro-1-methylindol-3-yl)acetonitrile. InChIKey: IYMMTYZBYGMAPP-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2 |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 2-(6-fluoro-1-methylindol-3-yl)acetonitrile |
| InChIKey | IYMMTYZBYGMAPP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)F)CC#N |
Computed by PubChem (NCBI)