Products 1368491-82-0
CAS 1368491-82-0 is the registry number for 2-(1-Methyl-1H-benzo[d]imidazol-5-yl)propan-2-amine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-(1-methylbenzimidazol-5-yl)propan-2-amine (CAS 1368491-82-0) is a chemical compound with the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. IUPAC name: 2-(1-methylbenzimidazol-5-yl)propan-2-amine. InChIKey: HNJMAFZLRDFUKP-UHFFFAOYSA-N.
| Molecular formula | C11H15N3 |
|---|---|
| Molecular weight | 189.26 g/mol |
| IUPAC name | 2-(1-methylbenzimidazol-5-yl)propan-2-amine |
| InChIKey | HNJMAFZLRDFUKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C=C1)N(C=N2)C)N |
Computed by PubChem (NCBI)