Products 1368587-97-6
CAS 1368587-97-6 appears in our catalog under these names: 7-(3-Aminopropyl)-5,7-diazaspiro(3.4)octane-6,8-dione, 7-(3-Aminopropyl)-5,7-diazaspiro(3.4)octane-6,8-dione, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 500mg, 1g, 0,5g, 50mg.
7-(3-aminopropyl)-5,7-diazaspiro[3.4]octane-6,8-dione (CAS 1368587-97-6) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: 7-(3-aminopropyl)-5,7-diazaspiro[3.4]octane-6,8-dione. InChIKey: KAJGNGVLCMJHJB-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 7-(3-aminopropyl)-5,7-diazaspiro[3.4]octane-6,8-dione |
| InChIKey | KAJGNGVLCMJHJB-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(=O)N(C(=O)N2)CCCN |
Computed by PubChem (NCBI)