Products 136861-97-7
CAS 136861-97-7 appears in our catalog under these names: Cyclophellitol aziridine, Cyclophellitol aziridine, 95.0%, Cyclophellitol aziridine, 95%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.
(1R,2S,3S,4R,5R,6R)-5-(hydroxymethyl)-7-azabicyclo[4.1.0]heptane-2,3,4-triol (CAS 136861-97-7) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (1R,2S,3S,4R,5R,6R)-5-(hydroxymethyl)-7-azabicyclo[4.1.0]heptane-2,3,4-triol. InChIKey: GPIFFOGPRPKRHS-DRYVTRLFSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (1R,2S,3S,4R,5R,6R)-5-(hydroxymethyl)-7-azabicyclo[4.1.0]heptane-2,3,4-triol |
| InChIKey | GPIFFOGPRPKRHS-DRYVTRLFSA-N |
| SMILES | C([C@H]1[C@@H]2[C@@H](N2)[C@@H]([C@H]([C@@H]1O)O)O)O |
Computed by PubChem (NCBI)