Products 1368625-51-7
CAS 1368625-51-7 is the registry number for 5-tert-butyl-1-ethyl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
5-tert-butyl-1-ethylpyrazole-3-carboxylic acid (CAS 1368625-51-7) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 5-tert-butyl-1-ethylpyrazole-3-carboxylic acid. InChIKey: LWJBXVUABPYBPU-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 5-tert-butyl-1-ethylpyrazole-3-carboxylic acid |
| InChIKey | LWJBXVUABPYBPU-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=N1)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)