CAS 1368708-97-7 is the registry number for 7-Amino-5-chloroindolin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-5-chloro-1,3-dihydroindol-2-one (CAS 1368708-97-7) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 7-amino-5-chloro-1,3-dihydroindol-2-one. InChIKey: IQUDXSGAIKORKW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-amino-5-chloro-1,3-dihydroindol-2-one |
| InChIKey | IQUDXSGAIKORKW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Cl)N)NC1=O |
Computed by PubChem (NCBI)