CAS 1368714-46-8 is the registry number for 2-(4-Isopropylphenyl)acrylic Acid. Offered by: Mikromol. Available pack sizes: 25mg.
2-(4-propan-2-ylphenyl)prop-2-enoic acid (CAS 1368714-46-8) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)prop-2-enoic acid. InChIKey: KBDNRDJFVITYCM-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)prop-2-enoic acid |
| InChIKey | KBDNRDJFVITYCM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=C)C(=O)O |
Computed by PubChem (NCBI)