Products 1368775-50-1
CAS 1368775-50-1 is the registry number for 1-Bromo-5-chloro-4-ethoxy-2-methylbenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-5-chloro-4-ethoxy-2-methylbenzene (CAS 1368775-50-1) is a chemical compound with the molecular formula C9H10BrClO and a molecular weight of 249.53 g/mol. IUPAC name: 1-bromo-5-chloro-4-ethoxy-2-methylbenzene. InChIKey: ARNIJYHPXDTWDL-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 1-bromo-5-chloro-4-ethoxy-2-methylbenzene |
| InChIKey | ARNIJYHPXDTWDL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C)Br)Cl |
Computed by PubChem (NCBI)